C23H19FN2O3 — CID 133239456
N-benzyl-4-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133239456) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-benzyl-4-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-benzyl-4-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133239456 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-benzyl-4-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CN(C(=O)c2ccc(F)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C23H19FN2O3/c24-18-12-10-17(11-13-18)23(28)26-15-21(29-20-9-5-4-8-19(20)26)22(27)25-14-16-6-2-1-3-7-16/h1-13,21H,14-15H2,(H,25,27) |
| InChIKey | IZOSAJWIZJMOTG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |