C15H24N2O4S — CID 133241816
N-tert-butyl-3-(methanesulfonamido)-3-(4-methoxyphenyl)propanamide (PubChem CID 133241816) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-tert-butyl-3-(methanesulfonamido)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-tert-butyl-3-(methanesulfonamido)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 133241816 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-tert-butyl-3-(methanesulfonamido)-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NC(C)(C)C)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O4S/c1-15(2,3)16-14(18)10-13(17-22(5,19)20)11-6-8-12(21-4)9-7-11/h6-9,13,17H,10H2,1-5H3,(H,16,18) |
| InChIKey | MXNZVLYGKOCXSG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |