C28H26N4O3S2 — CID 133243018
N-[2-methoxy-4-[5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide (PubChem CID 133243018) has the molecular formula C28H26N4O3S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is N-[2-methoxy-4-[5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide.
| Compound Name | N-[2-methoxy-4-[5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 133243018 |
| Molecular Formula | C28H26N4O3S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N-[2-methoxy-4-[5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(Sc3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C28H26N4O3S2/c1-3-24(33)30-20-13-12-18(17-23(20)34-2)32-27(26(31-28(32)36)21-11-7-8-16-29-21)22-14-15-25(35-22)37-19-9-5-4-6-10-19/h4-17,26-27H,3H2,1-2H3,(H,30,33)(H,31,36) |
| InChIKey | RDQIUROKKLREDI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|