C30H30ClN5O2S — CID 133243155
N-[4-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide (PubChem CID 133243155) has the molecular formula C30H30ClN5O2S and a molecular weight of 560.12 g/mol. Its IUPAC name is N-[4-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 133243155 |
| Molecular Formula | C30H30ClN5O2S |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | N-[4-[5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(Cl)c3C)c2C)cc1 |
| InChI | InChI=1S/C30H30ClN5O2S/c1-18-16-23(20(3)35(18)26-10-7-8-24(31)19(26)2)29-28(25-9-5-6-15-32-25)34-30(39)36(29)22-13-11-21(12-14-22)33-27(37)17-38-4/h5-16,28-29H,17H2,1-4H3,(H,33,37)(H,34,39) |
| InChIKey | PKUBOZAKXDHEIR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|