About N-butyl-2,2-dichloro-N-methylacetamide
N-butyl-2,2-dichloro-N-methylacetamide (PubChem CID 13324362) has the molecular formula C7H13Cl2NO
and a molecular weight of 198.09 g/mol. Its IUPAC name is N-butyl-2,2-dichloro-N-methylacetamide.
Molecular Properties
| Compound Name | N-butyl-2,2-dichloro-N-methylacetamide |
| PubChem CID | 13324362 |
| Molecular Formula | C7H13Cl2NO |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | N-butyl-2,2-dichloro-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C7H13Cl2NO/c1-3-4-5-10(2)7(11)6(8)9/h6H,3-5H2,1-2H3 |
| InChIKey | MUKKESDWVIPCBI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,2-dichloro-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,2-dichloro-N-methylacetamide?
The IUPAC name of N-butyl-2,2-dichloro-N-methylacetamide (CID 13324362) is N-butyl-2,2-dichloro-N-methylacetamide.
What is the SMILES notation for N-butyl-2,2-dichloro-N-methylacetamide?
The canonical SMILES for N-butyl-2,2-dichloro-N-methylacetamide is CCCCN(C)C(=O)C(Cl)Cl.
What is the InChIKey of N-butyl-2,2-dichloro-N-methylacetamide?
The InChIKey is MUKKESDWVIPCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl2NO/c1-3-4-5-10(2)7(11)6(8)9/h6H,3-5H2,1-2H3.
What are the key properties of N-butyl-2,2-dichloro-N-methylacetamide?
N-butyl-2,2-dichloro-N-methylacetamide has a molecular weight of 198.09 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,2-dichloro-N-methylacetamide is sourced from PubChem (CID 13324362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).