C30H30ClN5O3S — CID 133243872
N-[5-[5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide (PubChem CID 133243872) has the molecular formula C30H30ClN5O3S and a molecular weight of 576.12 g/mol. Its IUPAC name is N-[5-[5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 133243872 |
| Molecular Formula | C30H30ClN5O3S |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | N-[5-[5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cc(Cl)ccc3OC)c2C)cc1NC(C)=O |
| InChI | InChI=1S/C30H30ClN5O3S/c1-17-14-22(18(2)35(17)25-15-20(31)9-11-27(25)39-5)29-28(23-8-6-7-13-32-23)34-30(40)36(29)21-10-12-26(38-4)24(16-21)33-19(3)37/h6-16,28-29H,1-5H3,(H,33,37)(H,34,40) |
| InChIKey | FEXUKFVMXLWJFS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|