C29H28N4O4S — CID 133243909
N-[5-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide (PubChem CID 133243909) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is N-[5-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 133243909 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-[5-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]acetamide |
| SMILES | CCOc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(OC)c(NC(C)=O)c3)o2)cc1 |
| InChI | InChI=1S/C29H28N4O4S/c1-4-36-21-11-8-19(9-12-21)24-14-15-26(37-24)28-27(22-7-5-6-16-30-22)32-29(38)33(28)20-10-13-25(35-3)23(17-20)31-18(2)34/h5-17,27-28H,4H2,1-3H3,(H,31,34)(H,32,38) |
| InChIKey | NAMOWYFHZKCTFM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|