C17H27NOS — CID 133244491
2-phenylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 133244491) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | 2-phenylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 133244491 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-phenylsulfanyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(Sc1ccccc1)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H27NOS/c1-13(20-14-10-8-7-9-11-14)15(19)18-17(5,6)12-16(2,3)4/h7-11,13H,12H2,1-6H3,(H,18,19) |
| InChIKey | IVKVIMSXLYCXQD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |