C20H26N2O2 — CID 13324452
6-methyl-9-(piperidin-1-ylmethyl)-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione (PubChem CID 13324452) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-methyl-9-(piperidin-1-ylmethyl)-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione.
| Compound Name | 6-methyl-9-(piperidin-1-ylmethyl)-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
|---|---|
| PubChem CID | 13324452 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 6-methyl-9-(piperidin-1-ylmethyl)-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
| SMILES | Cc1cc2c(c3c1CCC(CN1CCCCC1)C3=O)CCC(=O)N2 |
| InChI | InChI=1S/C20H26N2O2/c1-13-11-17-16(7-8-18(23)21-17)19-15(13)6-5-14(20(19)24)12-22-9-3-2-4-10-22/h11,14H,2-10,12H2,1H3,(H,21,23) |
| InChIKey | MSBHRKNHELCZTQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |