C20H28N2O2 — CID 13324464
9-(butylaminomethyl)-1,5-dimethyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione (PubChem CID 13324464) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 9-(butylaminomethyl)-1,5-dimethyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione.
| Compound Name | 9-(butylaminomethyl)-1,5-dimethyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
|---|---|
| PubChem CID | 13324464 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 9-(butylaminomethyl)-1,5-dimethyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
| SMILES | CCCCNCC1CCc2cc(C)c3c(c2C1=O)C(C)CC(=O)N3 |
| InChI | InChI=1S/C20H28N2O2/c1-4-5-8-21-11-15-7-6-14-9-13(3)19-17(18(14)20(15)24)12(2)10-16(23)22-19/h9,12,15,21H,4-8,10-11H2,1-3H3,(H,22,23) |
| InChIKey | MTSVNBQWUSMPFK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|