About [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate
[2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 1332468) has the molecular formula C20H14N2O5
and a molecular weight of 362.34 g/mol. Its IUPAC name is [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate |
| PubChem CID | 1332468 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnccn1)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N2O5/c23-18(13-26-20(25)17-12-21-10-11-22-17)14-6-8-16(9-7-14)27-19(24)15-4-2-1-3-5-15/h1-12H,13H2 |
| InChIKey | OLNLHKXJFIURPN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate (CID 1332468) is [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate is O=C(COC(=O)c1cnccn1)c1ccc(OC(=O)c2ccccc2)cc1.
What is the InChIKey of [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is OLNLHKXJFIURPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O5/c23-18(13-26-20(25)17-12-21-10-11-22-17)14-6-8-16(9-7-14)27-19(24)15-4-2-1-3-5-15/h1-12H,13H2.
What are the key properties of [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate?
[2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 362.34 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-benzoyloxyphenyl)-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 1332468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).