About [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine
[3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine (PubChem CID 13324725) has the molecular formula C15H15ClN2
and a molecular weight of 258.75 g/mol. Its IUPAC name is [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine |
| PubChem CID | 13324725 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine |
| SMILES | NCc1cccc(N2CCc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C15H15ClN2/c16-13-4-5-15-12(9-13)6-7-18(15)14-3-1-2-11(8-14)10-17/h1-5,8-9H,6-7,10,17H2 |
| InChIKey | GVQTWFVGZJDALE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine?
The IUPAC name of [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine (CID 13324725) is [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine.
What is the SMILES notation for [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine?
The canonical SMILES for [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine is NCc1cccc(N2CCc3cc(Cl)ccc32)c1.
What is the InChIKey of [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine?
The InChIKey is GVQTWFVGZJDALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2/c16-13-4-5-15-12(9-13)6-7-18(15)14-3-1-2-11(8-14)10-17/h1-5,8-9H,6-7,10,17H2.
What are the key properties of [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine?
[3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine has a molecular weight of 258.75 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-chloro-2,3-dihydroindol-1-yl)phenyl]methanamine is sourced from PubChem (CID 13324725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).