C10H20O4S — CID 13325422
(2S,3R,4S,5R)-2-(3-methylbutylsulfanyl)oxane-3,4,5-triol (PubChem CID 13325422) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(3-methylbutylsulfanyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(3-methylbutylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 13325422 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (2S,3R,4S,5R)-2-(3-methylbutylsulfanyl)oxane-3,4,5-triol |
| SMILES | CC(C)CCS[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H20O4S/c1-6(2)3-4-15-10-9(13)8(12)7(11)5-14-10/h6-13H,3-5H2,1-2H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | MYZGMSRIGXSTQH-RGOKHQFPSA-N |
| XLogP | 0.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |