C16H15Cl2FN2O3S — CID 133255165
N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide (PubChem CID 133255165) has the molecular formula C16H15Cl2FN2O3S and a molecular weight of 405.28 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 133255165 |
| Molecular Formula | C16H15Cl2FN2O3S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
| SMILES | CS(=O)(=O)NC(CC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15Cl2FN2O3S/c1-25(23,24)21-15(10-2-4-11(19)5-3-10)9-16(22)20-12-6-7-13(17)14(18)8-12/h2-8,15,21H,9H2,1H3,(H,20,22) |
| InChIKey | DRGSGIDBTUUZNR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |