C20H25ClN2O3S — CID 133255349
3-(4-chlorophenyl)-3-(methanesulfonamido)-N-(4-phenylbutan-2-yl)propanamide (PubChem CID 133255349) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-(4-phenylbutan-2-yl)propanamide.
| Compound Name | 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-(4-phenylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 133255349 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-(4-phenylbutan-2-yl)propanamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CC(NS(C)(=O)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O3S/c1-15(8-9-16-6-4-3-5-7-16)22-20(24)14-19(23-27(2,25)26)17-10-12-18(21)13-11-17/h3-7,10-13,15,19,23H,8-9,14H2,1-2H3,(H,22,24) |
| InChIKey | OWRUNBBUXROQDO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |