C22H26BrFN2O2 — CID 133258412
2-[(3-bromophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-N-butan-2-ylpropanamide (PubChem CID 133258412) has the molecular formula C22H26BrFN2O2 and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-N-butan-2-ylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 133258412 |
| Molecular Formula | C22H26BrFN2O2 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(2-fluorophenyl)acetyl]amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C22H26BrFN2O2/c1-4-15(2)25-22(28)16(3)26(14-17-8-7-10-19(23)12-17)21(27)13-18-9-5-6-11-20(18)24/h5-12,15-16H,4,13-14H2,1-3H3,(H,25,28) |
| InChIKey | QRUJRDAVIRBUDE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |