C36H40ClN3O6S — CID 133258501
N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133258501) has the molecular formula C36H40ClN3O6S and a molecular weight of 678.25 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133258501 |
| Molecular Formula | C36H40ClN3O6S |
| Molecular Weight | 678.25 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-(2-methoxy-N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1ccccc1OC)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H40ClN3O6S/c1-4-5-23-38-36(42)33(24-27-13-7-6-8-14-27)39(25-28-15-9-10-16-31(28)37)35(41)26-40(32-17-11-12-18-34(32)46-3)47(43,44)30-21-19-29(45-2)20-22-30/h6-22,33H,4-5,23-26H2,1-3H3,(H,38,42) |
| InChIKey | RMUCCYQXFHYEEY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.25 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|