C23H22ClFN2O3S — CID 133260963
2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 133260963) has the molecular formula C23H22ClFN2O3S and a molecular weight of 460.96 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 133260963 |
| Molecular Formula | C23H22ClFN2O3S |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1ccc(N(C)S(=O)(=O)c2ccc(Cl)cc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22ClFN2O3S/c1-16(18-5-9-20(25)10-6-18)26-23(28)15-17-3-11-21(12-4-17)27(2)31(29,30)22-13-7-19(24)8-14-22/h3-14,16H,15H2,1-2H3,(H,26,28) |
| InChIKey | CBEATGXRHKDHBN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |