C17H17ClFNO — CID 133262276
4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]-2-fluorobenzamide (PubChem CID 133262276) has the molecular formula C17H17ClFNO and a molecular weight of 305.78 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 133262276 |
| Molecular Formula | C17H17ClFNO |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]-2-fluorobenzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(Cl)cc2F)cc1C |
| InChI | InChI=1S/C17H17ClFNO/c1-10-4-5-13(8-11(10)2)12(3)20-17(21)15-7-6-14(18)9-16(15)19/h4-9,12H,1-3H3,(H,20,21) |
| InChIKey | QKSNQAZBWGFRSV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |