C16H24FN5O2 — CID 133264730
(1S,5S,6R,7S)-6-N-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-7-N,7-N-dimethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 133264730) has the molecular formula C16H24FN5O2 and a molecular weight of 337.40 g/mol. Its IUPAC name is (1S,5S,6R,7S)-6-N-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-7-N,7-N-dimethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
| Compound Name | (1S,5S,6R,7S)-6-N-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-7-N,7-N-dimethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
|---|---|
| PubChem CID | 133264730 |
| Molecular Formula | C16H24FN5O2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1S,5S,6R,7S)-6-N-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-7-N,7-N-dimethyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | CN(C)[C@H]1[C@H](Nc2ncc(F)c(N3CCOCC3)n2)[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C16H24FN5O2/c1-21(2)13-12(10-3-6-24-14(10)13)19-16-18-9-11(17)15(20-16)22-4-7-23-8-5-22/h9-10,12-14H,3-8H2,1-2H3,(H,18,19,20)/t10-,12+,13-,14-/m0/s1 |
| InChIKey | LZTDQIOQGPBWQD-GHYVTOPFSA-N |
| XLogP | 0.58 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |