C17H26N2O3S — CID 133264846
2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide (PubChem CID 133264846) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide.
| Compound Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 133264846 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]acetamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)Cc1nc(C)sc1C |
| InChI | InChI=1S/C17H26N2O3S/c1-11(2)5-8-22-16-6-7-21-10-15(16)19-17(20)9-14-12(3)23-13(4)18-14/h5,15-16H,6-10H2,1-4H3,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | LHAVMQGXQKBJGJ-JKSUJKDBSA-N |
| XLogP | 2.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|