C19H23N3O4 — CID 133265679
N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 133265679) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 133265679 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C19H23N3O4/c1-13(2)6-10-26-16-7-9-25-12-15(16)21-18(23)14-11-20-17-5-3-4-8-22(17)19(14)24/h3-6,8,11,15-16H,7,9-10,12H2,1-2H3,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | FSSBBOOHQUCKLE-JKSUJKDBSA-N |
| XLogP | 1.56 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|