C16H26N4O3 — CID 133266943
N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(4-methyl-1,2,4-triazol-3-yl)propanamide (PubChem CID 133266943) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(4-methyl-1,2,4-triazol-3-yl)propanamide.
| Compound Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(4-methyl-1,2,4-triazol-3-yl)propanamide |
|---|---|
| PubChem CID | 133266943 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(4-methyl-1,2,4-triazol-3-yl)propanamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NC(=O)CCc1nncn1C |
| InChI | InChI=1S/C16H26N4O3/c1-12(2)6-9-23-14-7-8-22-10-13(14)18-16(21)5-4-15-19-17-11-20(15)3/h6,11,13-14H,4-5,7-10H2,1-3H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | HQTZZDZRPYHFOU-UONOGXRCSA-N |
| XLogP | 1.00 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|