C17H25NO3S — CID 133268059
4-(butylsulfanylmethyl)-5-methyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]furan-2-carboxamide (PubChem CID 133268059) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-(butylsulfanylmethyl)-5-methyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]furan-2-carboxamide.
| Compound Name | 4-(butylsulfanylmethyl)-5-methyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133268059 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-(butylsulfanylmethyl)-5-methyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]furan-2-carboxamide |
| SMILES | CCCCSCc1cc(C(=O)N[C@@H]2C[C@H]3OCC[C@@H]23)oc1C |
| InChI | InChI=1S/C17H25NO3S/c1-3-4-7-22-10-12-8-16(21-11(12)2)17(19)18-14-9-15-13(14)5-6-20-15/h8,13-15H,3-7,9-10H2,1-2H3,(H,18,19)/t13-,14+,15+/m0/s1 |
| InChIKey | SWOMBHOCNJRVAJ-RRFJBIMHSA-N |
| XLogP | 3.53 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|