C15H19NO2 — CID 133268115
2,4-dimethyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]benzamide (PubChem CID 133268115) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]benzamide.
| Compound Name | 2,4-dimethyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]benzamide |
|---|---|
| PubChem CID | 133268115 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2,4-dimethyl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2C[C@H]3OCC[C@@H]23)c(C)c1 |
| InChI | InChI=1S/C15H19NO2/c1-9-3-4-11(10(2)7-9)15(17)16-13-8-14-12(13)5-6-18-14/h3-4,7,12-14H,5-6,8H2,1-2H3,(H,16,17)/t12-,13+,14+/m0/s1 |
| InChIKey | RFYNZAQFIWBPCK-BFHYXJOUSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |