C14H21FN4O2 — CID 133268879
5-fluoro-2-N-[(1R,5R,6R,7R)-7-(methoxymethyl)-2-oxabicyclo[3.2.0]heptan-6-yl]-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 133268879) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-fluoro-2-N-[(1R,5R,6R,7R)-7-(methoxymethyl)-2-oxabicyclo[3.2.0]heptan-6-yl]-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[(1R,5R,6R,7R)-7-(methoxymethyl)-2-oxabicyclo[3.2.0]heptan-6-yl]-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133268879 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-fluoro-2-N-[(1R,5R,6R,7R)-7-(methoxymethyl)-2-oxabicyclo[3.2.0]heptan-6-yl]-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | COC[C@H]1[C@H](Nc2ncc(F)c(N(C)C)n2)[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C14H21FN4O2/c1-19(2)13-10(15)6-16-14(18-13)17-11-8-4-5-21-12(8)9(11)7-20-3/h6,8-9,11-12H,4-5,7H2,1-3H3,(H,16,17,18)/t8-,9+,11-,12-/m1/s1 |
| InChIKey | YASQVSBDHJFQIA-RBLKWDMZSA-N |
| XLogP | 1.14 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |