C18H28O2 — CID 133268894
(3aR,5aR,6R)-6-hydroxy-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-2-one (PubChem CID 133268894) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (3aR,5aR,6R)-6-hydroxy-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-2-one.
| Compound Name | (3aR,5aR,6R)-6-hydroxy-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-2-one |
|---|---|
| PubChem CID | 133268894 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3aR,5aR,6R)-6-hydroxy-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydro-1H-indeno[5,4-e]inden-2-one |
| SMILES | C[C@@]12CC(=O)CC1CCC1C2CC[C@]2(C)C1CC[C@H]2O |
| InChI | InChI=1S/C18H28O2/c1-17-8-7-15-13(14(17)5-6-16(17)20)4-3-11-9-12(19)10-18(11,15)2/h11,13-16,20H,3-10H2,1-2H3/t11?,13?,14?,15?,16-,17-,18-/m1/s1 |
| InChIKey | ZRIOQYDHRPOBLF-PLFRGWOCSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |