C26H28N2O5 — CID 133269124
(3aR,6R)-3-(4-methoxyphenyl)-6-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-3a-methyl-5,6,7,7a-tetrahydro-1,2-benzoxazol-4-one (PubChem CID 133269124) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (3aR,6R)-3-(4-methoxyphenyl)-6-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-3a-methyl-5,6,7,7a-tetrahydro-1,2-benzoxazol-4-one.
| Compound Name | (3aR,6R)-3-(4-methoxyphenyl)-6-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-3a-methyl-5,6,7,7a-tetrahydro-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 133269124 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (3aR,6R)-3-(4-methoxyphenyl)-6-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-3a-methyl-5,6,7,7a-tetrahydro-1,2-benzoxazol-4-one |
| SMILES | COc1ccc(C2=NOC(C)([C@H]3CC(=O)[C@]4(C)C(c5ccc(OC)cc5)=NOC4C3)C2)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-25(15-21(27-33-25)16-5-9-19(30-3)10-6-16)18-13-22(29)26(2)23(14-18)32-28-24(26)17-7-11-20(31-4)12-8-17/h5-12,18,23H,13-15H2,1-4H3/t18-,23?,25?,26-/m0/s1 |
| InChIKey | LIADFWPROBIAMI-UIDIENMYSA-N |
| XLogP | 4.38 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |