About [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate
[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate (PubChem CID 13326918) has the molecular formula C15H12FN3O5S
and a molecular weight of 365.34 g/mol. Its IUPAC name is [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate |
| PubChem CID | 13326918 |
| Molecular Formula | C15H12FN3O5S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate |
| SMILES | COC(=O)Nc1nc2ccc(OS(=O)(=O)c3cccc(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H12FN3O5S/c1-23-15(20)19-14-17-12-6-5-10(8-13(12)18-14)24-25(21,22)11-4-2-3-9(16)7-11/h2-8H,1H3,(H2,17,18,19,20) |
| InChIKey | NHGCIPXCUDYTRT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate?
The IUPAC name of [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate (CID 13326918) is [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate.
What is the SMILES notation for [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate?
The canonical SMILES for [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate is COC(=O)Nc1nc2ccc(OS(=O)(=O)c3cccc(F)c3)cc2[nH]1.
What is the InChIKey of [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate?
The InChIKey is NHGCIPXCUDYTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O5S/c1-23-15(20)19-14-17-12-6-5-10(8-13(12)18-14)24-25(21,22)11-4-2-3-9(16)7-11/h2-8H,1H3,(H2,17,18,19,20).
What are the key properties of [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate?
[2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate has a molecular weight of 365.34 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methoxycarbonylamino)-3H-benzimidazol-5-yl] 3-fluorobenzenesulfonate is sourced from PubChem (CID 13326918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).