C16H18ClN3OS — CID 133270974
[5-chloro-6-(thiophen-3-ylmethylamino)-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 133270974) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is [5-chloro-6-(thiophen-3-ylmethylamino)-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-6-(thiophen-3-ylmethylamino)-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 133270974 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [5-chloro-6-(thiophen-3-ylmethylamino)-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnc(NCc2ccsc2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C16H18ClN3OS/c17-14-8-13(16(21)20-5-2-1-3-6-20)10-19-15(14)18-9-12-4-7-22-11-12/h4,7-8,10-11H,1-3,5-6,9H2,(H,18,19) |
| InChIKey | UVCVOKJEEYQLQQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |