C19H22ClN3O2 — CID 133272354
5-chloro-6-[[4-(2-methylphenyl)oxan-4-yl]methylamino]pyridine-3-carboxamide (PubChem CID 133272354) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 5-chloro-6-[[4-(2-methylphenyl)oxan-4-yl]methylamino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[[4-(2-methylphenyl)oxan-4-yl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133272354 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-chloro-6-[[4-(2-methylphenyl)oxan-4-yl]methylamino]pyridine-3-carboxamide |
| SMILES | Cc1ccccc1C1(CNc2ncc(C(N)=O)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-13-4-2-3-5-15(13)19(6-8-25-9-7-19)12-23-18-16(20)10-14(11-22-18)17(21)24/h2-5,10-11H,6-9,12H2,1H3,(H2,21,24)(H,22,23) |
| InChIKey | XLRBFNLKYZXXFL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |