About 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate
1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 13327279) has the molecular formula C18H38O5Si2
and a molecular weight of 390.67 g/mol. Its IUPAC name is 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
Molecular Properties
| Compound Name | 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| PubChem CID | 13327279 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| SMILES | COC(=O)CC(CC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si2/c1-17(2,3)24(8,9)22-14(12-15(19)21-7)13-16(20)23-25(10,11)18(4,5)6/h14H,12-13H2,1-11H3 |
| InChIKey | SDOVSJFWHMOHLD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The IUPAC name of 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate (CID 13327279) is 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
What is the SMILES notation for 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The canonical SMILES for 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate is COC(=O)CC(CC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The InChIKey is SDOVSJFWHMOHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O5Si2/c1-17(2,3)24(8,9)22-14(12-15(19)21-7)13-16(20)23-25(10,11)18(4,5)6/h14H,12-13H2,1-11H3.
What are the key properties of 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate has a molecular weight of 390.67 g/mol, XLogP of 4.88, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[tert-butyl(dimethyl)silyl] 5-O-methyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate is sourced from PubChem (CID 13327279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).