diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate

C15H30O5Si — CID 13327289

IUPACdiethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate
SMILESCCOC(=O)CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C15H30O5Si/c1-8-18-13(16)10-12(11-14(17)19-9-2)20-21(6,7)15(3,4)5/h12H,8-11H2,1-7H3
InChIKeyPPZUZFQSSULNGN-UHFFFAOYSA-N
MW318.49 g/mol
LogP3.28
Rot. Bonds8

About diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate

diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 13327289) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate.

Molecular Properties

Compound Namediethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate
PubChem CID13327289
Molecular FormulaC15H30O5Si
Molecular Weight318.49 g/mol
Exact Mass318.19
IUPAC Namediethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate
SMILESCCOC(=O)CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C15H30O5Si/c1-8-18-13(16)10-12(11-14(17)19-9-2)20-21(6,7)15(3,4)5/h12H,8-11H2,1-7H3
InChIKeyPPZUZFQSSULNGN-UHFFFAOYSA-N
XLogP3.28
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.49
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The IUPAC name of diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate (CID 13327289) is diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
What is the SMILES notation for diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The canonical SMILES for diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate is CCOC(=O)CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The InChIKey is PPZUZFQSSULNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O5Si/c1-8-18-13(16)10-12(11-14(17)19-9-2)20-21(6,7)15(3,4)5/h12H,8-11H2,1-7H3.
What are the key properties of diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate has a molecular weight of 318.49 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-[tert-butyl(dimethyl)silyl]oxypentanedioate is sourced from PubChem (CID 13327289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).