About 2,2-dimethyloxolan-3-ol
2,2-dimethyloxolan-3-ol (PubChem CID 13327310) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2,2-dimethyloxolan-3-ol.
Molecular Properties
| Compound Name | 2,2-dimethyloxolan-3-ol |
| PubChem CID | 13327310 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2,2-dimethyloxolan-3-ol |
| SMILES | CC1(C)OCCC1O |
| InChI | InChI=1S/C6H12O2/c1-6(2)5(7)3-4-8-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | PBVVKKCMOMDGNB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxolan-3-ol?
The IUPAC name of 2,2-dimethyloxolan-3-ol (CID 13327310) is 2,2-dimethyloxolan-3-ol.
What is the SMILES notation for 2,2-dimethyloxolan-3-ol?
The canonical SMILES for 2,2-dimethyloxolan-3-ol is CC1(C)OCCC1O.
What is the InChIKey of 2,2-dimethyloxolan-3-ol?
The InChIKey is PBVVKKCMOMDGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-6(2)5(7)3-4-8-6/h5,7H,3-4H2,1-2H3.
What are the key properties of 2,2-dimethyloxolan-3-ol?
2,2-dimethyloxolan-3-ol has a molecular weight of 116.16 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxolan-3-ol is sourced from PubChem (CID 13327310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).