C17H22N4O2 — CID 133273649
6-nitro-N-(1-piperidin-1-ylpropan-2-yl)quinolin-2-amine (PubChem CID 133273649) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-nitro-N-(1-piperidin-1-ylpropan-2-yl)quinolin-2-amine.
| Compound Name | 6-nitro-N-(1-piperidin-1-ylpropan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 133273649 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 6-nitro-N-(1-piperidin-1-ylpropan-2-yl)quinolin-2-amine |
| SMILES | CC(CN1CCCCC1)Nc1ccc2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C17H22N4O2/c1-13(12-20-9-3-2-4-10-20)18-17-8-5-14-11-15(21(22)23)6-7-16(14)19-17/h5-8,11,13H,2-4,9-10,12H2,1H3,(H,18,19) |
| InChIKey | IPWOHIVYFPKRNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|