About 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide
2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide (PubChem CID 133273908) has the molecular formula C14H20N6O
and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide |
| PubChem CID | 133273908 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide |
| SMILES | Cc1cc(C)n(-c2cncc(N(C)CC(=O)N(C)C)n2)n1 |
| InChI | InChI=1S/C14H20N6O/c1-10-6-11(2)20(17-10)13-8-15-7-12(16-13)19(5)9-14(21)18(3)4/h6-8H,9H2,1-5H3 |
| InChIKey | KHEMGMWHIDHWER-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide (CID 133273908) is 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide is Cc1cc(C)n(-c2cncc(N(C)CC(=O)N(C)C)n2)n1.
What is the InChIKey of 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide?
The InChIKey is KHEMGMWHIDHWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O/c1-10-6-11(2)20(17-10)13-8-15-7-12(16-13)19(5)9-14(21)18(3)4/h6-8H,9H2,1-5H3.
What are the key properties of 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide?
2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide has a molecular weight of 288.36 g/mol, XLogP of 0.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]-methylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 133273908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).