C17H14F3N7 — CID 133274103
N-quinolin-2-yl-N'-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]ethane-1,2-diamine (PubChem CID 133274103) has the molecular formula C17H14F3N7 and a molecular weight of 373.34 g/mol. Its IUPAC name is N-quinolin-2-yl-N'-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]ethane-1,2-diamine.
| Compound Name | N-quinolin-2-yl-N'-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 133274103 |
| Molecular Formula | C17H14F3N7 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-quinolin-2-yl-N'-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]ethane-1,2-diamine |
| SMILES | FC(F)(F)c1cc(NCCNc2ccc3ccccc3n2)n2ncnc2n1 |
| InChI | InChI=1S/C17H14F3N7/c18-17(19,20)13-9-15(27-16(26-13)23-10-24-27)22-8-7-21-14-6-5-11-3-1-2-4-12(11)25-14/h1-6,9-10,22H,7-8H2,(H,21,25) |
| InChIKey | PXEPPOGYOINDDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|