About dimethyl propanediimidothioate
dimethyl propanediimidothioate (PubChem CID 13327497) has the molecular formula C5H10N2S2
and a molecular weight of 162.28 g/mol. Its IUPAC name is dimethyl propanediimidothioate.
Molecular Properties
| Compound Name | dimethyl propanediimidothioate |
| PubChem CID | 13327497 |
| Molecular Formula | C5H10N2S2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | dimethyl propanediimidothioate |
| SMILES | [H]/N=C(/C/C(=N/[H])SC)SC |
| InChI | InChI=1S/C5H10N2S2/c1-8-4(6)3-5(7)9-2/h6-7H,3H2,1-2H3/b6-4-,7-5- |
| InChIKey | VTPUMCAIFBEVSC-PEPZGXQESA-N |
| XLogP | 2.06 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl propanediimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl propanediimidothioate?
The IUPAC name of dimethyl propanediimidothioate (CID 13327497) is dimethyl propanediimidothioate.
What is the SMILES notation for dimethyl propanediimidothioate?
The canonical SMILES for dimethyl propanediimidothioate is [H]/N=C(/C/C(=N/[H])SC)SC.
What is the InChIKey of dimethyl propanediimidothioate?
The InChIKey is VTPUMCAIFBEVSC-PEPZGXQESA-N. The full InChI is InChI=1S/C5H10N2S2/c1-8-4(6)3-5(7)9-2/h6-7H,3H2,1-2H3/b6-4-,7-5-.
What are the key properties of dimethyl propanediimidothioate?
dimethyl propanediimidothioate has a molecular weight of 162.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl propanediimidothioate is sourced from PubChem (CID 13327497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).