C19H30N4OS2 — CID 133275941
N-(2-tert-butylsulfanylethyl)-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133275941) has the molecular formula C19H30N4OS2 and a molecular weight of 394.61 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-tert-butylsulfanylethyl)-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133275941 |
| Molecular Formula | C19H30N4OS2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(NCCSC(C)(C)C)c2c1C |
| InChI | InChI=1S/C19H30N4OS2/c1-13-14(2)26-18-16(13)17(20-6-11-25-19(3,4)5)21-15(22-18)12-23-7-9-24-10-8-23/h6-12H2,1-5H3,(H,20,21,22) |
| InChIKey | IRCCCKGVMJWJBM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|