C18H15ClN6S — CID 133281560
6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 133281560) has the molecular formula C18H15ClN6S and a molecular weight of 382.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133281560 |
| Molecular Formula | C18H15ClN6S |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(-c2cc3ncnc(NC4CCc5ncnn5C4)c3s2)cc1 |
| InChI | InChI=1S/C18H15ClN6S/c19-12-3-1-11(2-4-12)15-7-14-17(26-15)18(22-9-20-14)24-13-5-6-16-21-10-23-25(16)8-13/h1-4,7,9-10,13H,5-6,8H2,(H,20,22,24) |
| InChIKey | BBDCOJWXONFIPZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |