C14H32N4 — CID 13328161
5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 13328161) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 13328161 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 5,7,12,14-tetramethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC1CC(C)NCCNC(C)CC(C)NCCN1 |
| InChI | InChI=1S/C14H32N4/c1-11-9-12(2)16-7-8-18-14(4)10-13(3)17-6-5-15-11/h11-18H,5-10H2,1-4H3 |
| InChIKey | BYCJOZGALLHAHI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |