C21H23ClN6O2 — CID 133283594
N-(5-chloro-2-hydroxyphenyl)-1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]piperidine-4-carboxamide (PubChem CID 133283594) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133283594 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C)n(-c2cncc(N3CCC(C(=O)Nc4cc(Cl)ccc4O)CC3)n2)n1 |
| InChI | InChI=1S/C21H23ClN6O2/c1-13-9-14(2)28(26-13)20-12-23-11-19(25-20)27-7-5-15(6-8-27)21(30)24-17-10-16(22)3-4-18(17)29/h3-4,9-12,15,29H,5-8H2,1-2H3,(H,24,30) |
| InChIKey | MPTUPGJINVBVJA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|