About 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile
3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile (PubChem CID 133284845) has the molecular formula C13H12N6O
and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile |
| PubChem CID | 133284845 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile |
| SMILES | COc1ncnc2c1CN(c1nccnc1C#N)CC2 |
| InChI | InChI=1S/C13H12N6O/c1-20-13-9-7-19(5-2-10(9)17-8-18-13)12-11(6-14)15-3-4-16-12/h3-4,8H,2,5,7H2,1H3 |
| InChIKey | OIFBPABHLQAJKZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile?
The IUPAC name of 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile (CID 133284845) is 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile.
What is the SMILES notation for 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile?
The canonical SMILES for 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile is COc1ncnc2c1CN(c1nccnc1C#N)CC2.
What is the InChIKey of 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile?
The InChIKey is OIFBPABHLQAJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6O/c1-20-13-9-7-19(5-2-10(9)17-8-18-13)12-11(6-14)15-3-4-16-12/h3-4,8H,2,5,7H2,1H3.
What are the key properties of 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile?
3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile has a molecular weight of 268.28 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)pyrazine-2-carbonitrile is sourced from PubChem (CID 133284845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).