C20H20FN7O — CID 133284931
5-[1-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-3-yl]-3-(3-fluorophenyl)-1,2,4-oxadiazole (PubChem CID 133284931) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is 5-[1-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-3-yl]-3-(3-fluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[1-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-3-yl]-3-(3-fluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133284931 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-[1-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-3-yl]-3-(3-fluorophenyl)-1,2,4-oxadiazole |
| SMILES | CCc1cc(N2CCCC(c3nc(-c4cccc(F)c4)no3)C2)n2ncnc2n1 |
| InChI | InChI=1S/C20H20FN7O/c1-2-16-10-17(28-20(24-16)22-12-23-28)27-8-4-6-14(11-27)19-25-18(26-29-19)13-5-3-7-15(21)9-13/h3,5,7,9-10,12,14H,2,4,6,8,11H2,1H3 |
| InChIKey | ATRBKNBDJCGJOL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |