C16H14N4O3S — CID 133285288
4-[[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]amino]-3-nitrobenzonitrile (PubChem CID 133285288) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]amino]-3-nitrobenzonitrile.
| Compound Name | 4-[[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 133285288 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-[[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]amino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(NCC(=O)N2CCc3sccc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N4O3S/c17-8-11-1-2-13(14(7-11)20(22)23)18-9-16(21)19-5-3-15-12(10-19)4-6-24-15/h1-2,4,6-7,18H,3,5,9-10H2 |
| InChIKey | YYRRJIMKTHQSGO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|