C25H25N7O — CID 133285501
3-[(2-phenylquinazolin-4-yl)amino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 133285501) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[(2-phenylquinazolin-4-yl)amino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[(2-phenylquinazolin-4-yl)amino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 133285501 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[(2-phenylquinazolin-4-yl)amino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCNc1nc(-c2ccccc2)nc2ccccc12)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C25H25N7O/c33-22(31-15-17-32(18-16-31)25-27-12-6-13-28-25)11-14-26-24-20-9-4-5-10-21(20)29-23(30-24)19-7-2-1-3-8-19/h1-10,12-13H,11,14-18H2,(H,26,29,30) |
| InChIKey | MPIVJVMOOZCKHG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |