C22H16FN3O2S — CID 133286232
N-[4-[6-(4-fluorophenyl)pyridazin-3-yl]oxyphenyl]-3-methylthiophene-2-carboxamide (PubChem CID 133286232) has the molecular formula C22H16FN3O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[4-[6-(4-fluorophenyl)pyridazin-3-yl]oxyphenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[4-[6-(4-fluorophenyl)pyridazin-3-yl]oxyphenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 133286232 |
| Molecular Formula | C22H16FN3O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[4-[6-(4-fluorophenyl)pyridazin-3-yl]oxyphenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccc(Oc2ccc(-c3ccc(F)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H16FN3O2S/c1-14-12-13-29-21(14)22(27)24-17-6-8-18(9-7-17)28-20-11-10-19(25-26-20)15-2-4-16(23)5-3-15/h2-13H,1H3,(H,24,27) |
| InChIKey | ZZPBSQJXSWLSTG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |