C26H26N6O — CID 133286261
1-[3-[[(2-phenylquinazolin-4-yl)amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 133286261) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is 1-[3-[[(2-phenylquinazolin-4-yl)amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[(2-phenylquinazolin-4-yl)amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133286261 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[3-[[(2-phenylquinazolin-4-yl)amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncccc2CNc2nc(-c3ccccc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H26N6O/c27-23(33)18-12-15-32(16-13-18)26-20(9-6-14-28-26)17-29-25-21-10-4-5-11-22(21)30-24(31-25)19-7-2-1-3-8-19/h1-11,14,18H,12-13,15-17H2,(H2,27,33)(H,29,30,31) |
| InChIKey | ILIVPPSLTAHQDY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |