C10H14O2 — CID 13328664
2-methyl-2,3,5,6,7,8-hexahydrochromen-4-one (PubChem CID 13328664) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-methyl-2,3,5,6,7,8-hexahydrochromen-4-one.
| Compound Name | 2-methyl-2,3,5,6,7,8-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 13328664 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-methyl-2,3,5,6,7,8-hexahydrochromen-4-one |
| SMILES | CC1CC(=O)C2=C(CCCC2)O1 |
| InChI | InChI=1S/C10H14O2/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h7H,2-6H2,1H3 |
| InChIKey | OSRMVNCPCOQYNI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |