C16H10F3N3O5 — CID 133287394
3-nitro-2-[2-(2,2,2-trifluoroethoxy)phenoxy]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 133287394) has the molecular formula C16H10F3N3O5 and a molecular weight of 381.27 g/mol. Its IUPAC name is 3-nitro-2-[2-(2,2,2-trifluoroethoxy)phenoxy]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-nitro-2-[2-(2,2,2-trifluoroethoxy)phenoxy]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133287394 |
| Molecular Formula | C16H10F3N3O5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-nitro-2-[2-(2,2,2-trifluoroethoxy)phenoxy]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(Oc2ccccc2OCC(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C16H10F3N3O5/c17-16(18,19)9-26-10-5-1-2-6-11(10)27-14-13(22(24)25)15(23)21-8-4-3-7-12(21)20-14/h1-8H,9H2 |
| InChIKey | DRCLGKQXFBXZDA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|